C29H22F6N2O — CID 138680395
9,9-bis[4-amino-3-methyl-5-(trifluoromethyl)phenyl]fluoren-2-ol (PubChem CID 138680395) has the molecular formula C29H22F6N2O and a molecular weight of 528.50 g/mol. Its IUPAC name is 9,9-bis[4-amino-3-methyl-5-(trifluoromethyl)phenyl]fluoren-2-ol.
| Compound Name | 9,9-bis[4-amino-3-methyl-5-(trifluoromethyl)phenyl]fluoren-2-ol |
|---|---|
| PubChem CID | 138680395 |
| Molecular Formula | C29H22F6N2O |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 9,9-bis[4-amino-3-methyl-5-(trifluoromethyl)phenyl]fluoren-2-ol |
| SMILES | Cc1cc(C2(c3cc(C)c(N)c(C(F)(F)F)c3)c3ccccc3-c3ccc(O)cc32)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C29H22F6N2O/c1-14-9-16(11-23(25(14)36)28(30,31)32)27(17-10-15(2)26(37)24(12-17)29(33,34)35)21-6-4-3-5-19(21)20-8-7-18(38)13-22(20)27/h3-13,38H,36-37H2,1-2H3 |
| InChIKey | INTPCJNSZPRMJO-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|