C12H17F8NO — CID 138687368
1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine (PubChem CID 138687368) has the molecular formula C12H17F8NO and a molecular weight of 343.26 g/mol. Its IUPAC name is 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine.
| Compound Name | 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 138687368 |
| Molecular Formula | C12H17F8NO |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[1-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]piperidine |
| SMILES | CC(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)N1CCCCC1 |
| InChI | InChI=1S/C12H17F8NO/c1-8(21-5-3-2-4-6-21)22-7-10(15,16)12(19,20)11(17,18)9(13)14/h8-9H,2-7H2,1H3 |
| InChIKey | QOALMCSDFKOYTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|