C9H17N3 — CID 138702992
(3E)-3-[(1,3-dimethyldiaziridin-3-yl)methylidene]pent-4-en-2-amine (PubChem CID 138702992) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (3E)-3-[(1,3-dimethyldiaziridin-3-yl)methylidene]pent-4-en-2-amine.
| Compound Name | (3E)-3-[(1,3-dimethyldiaziridin-3-yl)methylidene]pent-4-en-2-amine |
|---|---|
| PubChem CID | 138702992 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (3E)-3-[(1,3-dimethyldiaziridin-3-yl)methylidene]pent-4-en-2-amine |
| SMILES | C=C/C(=C\C1(C)NN1C)C(C)N |
| InChI | InChI=1S/C9H17N3/c1-5-8(7(2)10)6-9(3)11-12(9)4/h5-7,11H,1,10H2,2-4H3/b8-6+ |
| InChIKey | SCXLACOMXOCWRE-SOFGYWHQSA-N |
| XLogP | 0.61 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|