About 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate
2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate (PubChem CID 138705308) has the molecular formula C29H34O5
and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate |
| PubChem CID | 138705308 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate |
| SMILES | O=C(CCCC1CC2CC1C1CC(CCOC(=O)c3ccc(O)cc3)CC21)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H34O5/c30-23-8-4-19(5-9-23)28(32)3-1-2-21-16-22-17-26(21)27-15-18(14-25(22)27)12-13-34-29(33)20-6-10-24(31)11-7-20/h4-11,18,21-22,25-27,30-31H,1-3,12-17H2 |
| InChIKey | APZOTDPAPMFRGF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate?
The IUPAC name of 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate (CID 138705308) is 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate.
What is the SMILES notation for 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate?
The canonical SMILES for 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate is O=C(CCCC1CC2CC1C1CC(CCOC(=O)c3ccc(O)cc3)CC21)c1ccc(O)cc1.
What is the InChIKey of 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate?
The InChIKey is APZOTDPAPMFRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34O5/c30-23-8-4-19(5-9-23)28(32)3-1-2-21-16-22-17-26(21)27-15-18(14-25(22)27)12-13-34-29(33)20-6-10-24(31)11-7-20/h4-11,18,21-22,25-27,30-31H,1-3,12-17H2.
What are the key properties of 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate?
2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate has a molecular weight of 462.59 g/mol, XLogP of 6.00, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-[4-(4-hydroxyphenyl)-4-oxobutyl]-4-tricyclo[5.2.1.02,6]decanyl]ethyl 4-hydroxybenzoate is sourced from PubChem (CID 138705308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).