C45H60O9 — CID 59798461
4-O-[[4-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl] 1-O,2-O-bis[[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] benzene-1,2,4-tricarboxylate (PubChem CID 59798461) has the molecular formula C45H60O9 and a molecular weight of 744.97 g/mol. Its IUPAC name is 4-O-[[4-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl] 1-O,2-O-bis[[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] benzene-1,2,4-tricarboxylate.
| Compound Name | 4-O-[[4-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl] 1-O,2-O-bis[[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 59798461 |
| Molecular Formula | C45H60O9 |
| Molecular Weight | 744.97 g/mol |
| Exact Mass | 744.42 |
| IUPAC Name | 4-O-[[4-(hydroxymethyl)-8-tricyclo[5.2.1.02,6]decanyl]methyl] 1-O,2-O-bis[[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl] benzene-1,2,4-tricarboxylate |
| SMILES | O=C(OCC1CC2CC1C1CC(CO)CC21)c1ccc(C(=O)OCC2CC3C4CC(CO)C(C4)C3C2)c(C(=O)OCC2CC3C4CC(CO)C(C4)C3C2)c1 |
| InChI | InChI=1S/C45H60O9/c46-16-22-3-33-28-11-31(38(15-28)39(33)4-22)21-54-43(49)25-1-2-32(44(50)52-19-23-5-34-26-9-29(17-47)36(13-26)40(34)7-23)42(12-25)45(51)53-20-24-6-35-27-10-30(18-48)37(14-27)41(35)8-24/h1-2,12,22-24,26-31,33-41,46-48H,3-11,13-21H2 |
| InChIKey | YXYQSZBQUQZJAJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.97 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|