About [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol
[4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol (PubChem CID 118501069) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol.
Analyze [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol?
The IUPAC name of [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol (CID 118501069) is [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol.
What is the SMILES notation for [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol?
The canonical SMILES for [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol is O=NCC1CC2C3CC(CO)C(C3)C2C1.
What is the InChIKey of [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol?
The InChIKey is ORUATCNONFDSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c14-6-9-3-8-4-11(9)12-2-7(5-13-15)1-10(8)12/h7-12,14H,1-6H2.
What are the key properties of [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol?
[4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol has a molecular weight of 209.29 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(nitrosomethyl)-8-tricyclo[5.2.1.02,6]decanyl]methanol is sourced from PubChem (CID 118501069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).