C24H50O4 — CID 159531057
decane;[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanol;methanol (PubChem CID 159531057) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is decane;[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanol;methanol.
| Compound Name | decane;[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanol;methanol |
|---|---|
| PubChem CID | 159531057 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | decane;[8-(hydroxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methanol;methanol |
| SMILES | CCCCCCCCCC.CO.CO.OCC1CC2C3CC(CO)C(C3)C2C1 |
| InChI | InChI=1S/C12H20O2.C10H22.2CH4O/c13-5-7-1-10-8-3-9(6-14)11(4-8)12(10)2-7;1-3-5-7-9-10-8-6-4-2;2*1-2/h7-14H,1-6H2;3-10H2,1-2H3;2*2H,1H3 |
| InChIKey | MCZQZHAWERQSPA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|