About [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate
[8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate (PubChem CID 155355976) has the molecular formula C16H24O6S2
and a molecular weight of 376.50 g/mol. Its IUPAC name is [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate.
Molecular Properties
| Compound Name | [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate |
| PubChem CID | 155355976 |
| Molecular Formula | C16H24O6S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate |
| SMILES | C=CS(=O)(=O)OCC1CC2C3CC(COS(=O)(=O)C=C)C(C3)C2C1 |
| InChI | InChI=1S/C16H24O6S2/c1-3-23(17,18)21-9-11-5-14-12-7-13(10-22-24(19,20)4-2)15(8-12)16(14)6-11/h3-4,11-16H,1-2,5-10H2 |
| InChIKey | HXXIUPZRPABVEM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate?
The IUPAC name of [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate (CID 155355976) is [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate.
What is the SMILES notation for [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate?
The canonical SMILES for [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate is C=CS(=O)(=O)OCC1CC2C3CC(COS(=O)(=O)C=C)C(C3)C2C1.
What is the InChIKey of [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate?
The InChIKey is HXXIUPZRPABVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O6S2/c1-3-23(17,18)21-9-11-5-14-12-7-13(10-22-24(19,20)4-2)15(8-12)16(14)6-11/h3-4,11-16H,1-2,5-10H2.
What are the key properties of [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate?
[8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate has a molecular weight of 376.50 g/mol, XLogP of 2.26, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(ethenylsulfonyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl ethenesulfonate is sourced from PubChem (CID 155355976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).