C18H28 — CID 156753274
4,8-bis(2-methylprop-2-enyl)tricyclo[5.2.1.02,6]decane (PubChem CID 156753274) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 4,8-bis(2-methylprop-2-enyl)tricyclo[5.2.1.02,6]decane.
| Compound Name | 4,8-bis(2-methylprop-2-enyl)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 156753274 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 4,8-bis(2-methylprop-2-enyl)tricyclo[5.2.1.02,6]decane |
| SMILES | C=C(C)CC1CC2C3CC(CC(=C)C)C(C3)C2C1 |
| InChI | InChI=1S/C18H28/c1-11(2)5-13-7-16-15-9-14(6-12(3)4)17(10-15)18(16)8-13/h13-18H,1,3,5-10H2,2,4H3 |
| InChIKey | JIQJXDQHXHTKDA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|