C16H24O2 — CID 20676849
[8-(3-methylbuta-1,3-dien-2-yloxy)-4-tricyclo[5.2.1.02,6]decanyl]methanol (PubChem CID 20676849) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is [8-(3-methylbuta-1,3-dien-2-yloxy)-4-tricyclo[5.2.1.02,6]decanyl]methanol.
| Compound Name | [8-(3-methylbuta-1,3-dien-2-yloxy)-4-tricyclo[5.2.1.02,6]decanyl]methanol |
|---|---|
| PubChem CID | 20676849 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [8-(3-methylbuta-1,3-dien-2-yloxy)-4-tricyclo[5.2.1.02,6]decanyl]methanol |
| SMILES | C=C(C)C(=C)OC1CC2CC1C1CC(CO)CC21 |
| InChI | InChI=1S/C16H24O2/c1-9(2)10(3)18-16-7-12-6-15(16)14-5-11(8-17)4-13(12)14/h11-17H,1,3-8H2,2H3 |
| InChIKey | CYFCBCIXLHTRNY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|