C21H32F2N2O2 — CID 138712347
N-[2-ethyl-3,5-difluoro-4-(4-methoxypiperidin-1-yl)-6-methylphenyl]hexanamide (PubChem CID 138712347) has the molecular formula C21H32F2N2O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[2-ethyl-3,5-difluoro-4-(4-methoxypiperidin-1-yl)-6-methylphenyl]hexanamide.
| Compound Name | N-[2-ethyl-3,5-difluoro-4-(4-methoxypiperidin-1-yl)-6-methylphenyl]hexanamide |
|---|---|
| PubChem CID | 138712347 |
| Molecular Formula | C21H32F2N2O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[2-ethyl-3,5-difluoro-4-(4-methoxypiperidin-1-yl)-6-methylphenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1c(C)c(F)c(N2CCC(OC)CC2)c(F)c1CC |
| InChI | InChI=1S/C21H32F2N2O2/c1-5-7-8-9-17(26)24-20-14(3)18(22)21(19(23)16(20)6-2)25-12-10-15(27-4)11-13-25/h15H,5-13H2,1-4H3,(H,24,26) |
| InChIKey | NCXVNDGARDUWPK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|