C23H27F3N2O — CID 138712461
N-[3,5-difluoro-4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-dimethylphenyl]hexanamide (PubChem CID 138712461) has the molecular formula C23H27F3N2O and a molecular weight of 404.48 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-dimethylphenyl]hexanamide.
| Compound Name | N-[3,5-difluoro-4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-dimethylphenyl]hexanamide |
|---|---|
| PubChem CID | 138712461 |
| Molecular Formula | C23H27F3N2O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[3,5-difluoro-4-(6-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)-2,6-dimethylphenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1c(C)c(F)c(N2CCc3cc(F)ccc3C2)c(F)c1C |
| InChI | InChI=1S/C23H27F3N2O/c1-4-5-6-7-19(29)27-22-14(2)20(25)23(21(26)15(22)3)28-11-10-16-12-18(24)9-8-17(16)13-28/h8-9,12H,4-7,10-11,13H2,1-3H3,(H,27,29) |
| InChIKey | HFNLGHXWEHNPQU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|