C26H34F2N2O — CID 138712356
N-[4-[3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5,5-dimethyl-2H-pyrrol-1-yl]-3,5-difluoro-2,6-dimethylphenyl]hexanamide (PubChem CID 138712356) has the molecular formula C26H34F2N2O and a molecular weight of 428.57 g/mol. Its IUPAC name is N-[4-[3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5,5-dimethyl-2H-pyrrol-1-yl]-3,5-difluoro-2,6-dimethylphenyl]hexanamide.
| Compound Name | N-[4-[3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5,5-dimethyl-2H-pyrrol-1-yl]-3,5-difluoro-2,6-dimethylphenyl]hexanamide |
|---|---|
| PubChem CID | 138712356 |
| Molecular Formula | C26H34F2N2O |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[4-[3-[(1Z)-buta-1,3-dienyl]-4-ethenyl-5,5-dimethyl-2H-pyrrol-1-yl]-3,5-difluoro-2,6-dimethylphenyl]hexanamide |
| SMILES | C=C/C=C\C1=C(C=C)C(C)(C)N(c2c(F)c(C)c(NC(=O)CCCCC)c(C)c2F)C1 |
| InChI | InChI=1S/C26H34F2N2O/c1-8-11-13-15-21(31)29-24-17(4)22(27)25(23(28)18(24)5)30-16-19(14-12-9-2)20(10-3)26(30,6)7/h9-10,12,14H,2-3,8,11,13,15-16H2,1,4-7H3,(H,29,31)/b14-12- |
| InChIKey | QBZXYUYEGSUIHO-OWBHPGMISA-N |
| XLogP | 6.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|