C21H14BrF4N5 — CID 138713695
4-bromo-2-[2-[(2-fluorophenyl)methyl]tetrazol-5-yl]-N-[3-(trifluoromethyl)phenyl]aniline (PubChem CID 138713695) has the molecular formula C21H14BrF4N5 and a molecular weight of 492.27 g/mol. Its IUPAC name is 4-bromo-2-[2-[(2-fluorophenyl)methyl]tetrazol-5-yl]-N-[3-(trifluoromethyl)phenyl]aniline.
| Compound Name | 4-bromo-2-[2-[(2-fluorophenyl)methyl]tetrazol-5-yl]-N-[3-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 138713695 |
| Molecular Formula | C21H14BrF4N5 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 4-bromo-2-[2-[(2-fluorophenyl)methyl]tetrazol-5-yl]-N-[3-(trifluoromethyl)phenyl]aniline |
| SMILES | Fc1ccccc1Cn1nnc(-c2cc(Br)ccc2Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H14BrF4N5/c22-15-8-9-19(27-16-6-3-5-14(10-16)21(24,25)26)17(11-15)20-28-30-31(29-20)12-13-4-1-2-7-18(13)23/h1-11,27H,12H2 |
| InChIKey | NFMFDYNZLPZBOE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |