C24H25ClN4O2S — CID 138714075
N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-2-chlorophenyl]methyl]-2-cyclopentylacetamide (PubChem CID 138714075) has the molecular formula C24H25ClN4O2S and a molecular weight of 469.01 g/mol. Its IUPAC name is N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-2-chlorophenyl]methyl]-2-cyclopentylacetamide.
| Compound Name | N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-2-chlorophenyl]methyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 138714075 |
| Molecular Formula | C24H25ClN4O2S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-2-chlorophenyl]methyl]-2-cyclopentylacetamide |
| SMILES | Nc1nc2c(O)cc(C#CCNc3cccc(CNC(=O)CC4CCCC4)c3Cl)cc2s1 |
| InChI | InChI=1S/C24H25ClN4O2S/c25-22-17(14-28-21(31)13-15-5-1-2-6-15)8-3-9-18(22)27-10-4-7-16-11-19(30)23-20(12-16)32-24(26)29-23/h3,8-9,11-12,15,27,30H,1-2,5-6,10,13-14H2,(H2,26,29)(H,28,31) |
| InChIKey | DRIZWTAWOHDVMN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|