C19H17FN4O3S2 — CID 138713874
N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-4-fluorophenyl]methyl]ethenesulfonamide (PubChem CID 138713874) has the molecular formula C19H17FN4O3S2 and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-4-fluorophenyl]methyl]ethenesulfonamide.
| Compound Name | N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-4-fluorophenyl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 138713874 |
| Molecular Formula | C19H17FN4O3S2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-[[3-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-4-fluorophenyl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCc1ccc(F)c(NCC#Cc2cc(O)c3nc(N)sc3c2)c1 |
| InChI | InChI=1S/C19H17FN4O3S2/c1-2-29(26,27)23-11-13-5-6-14(20)15(8-13)22-7-3-4-12-9-16(25)18-17(10-12)28-19(21)24-18/h2,5-6,8-10,22-23,25H,1,7,11H2,(H2,21,24) |
| InChIKey | ROARDPBUTIMIAU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|