C11H8N2O2S — CID 165057903
3-(4-hydroxy-2-methyl-1,3-benzothiazol-6-yl)prop-2-ynamide (PubChem CID 165057903) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methyl-1,3-benzothiazol-6-yl)prop-2-ynamide.
| Compound Name | 3-(4-hydroxy-2-methyl-1,3-benzothiazol-6-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 165057903 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 3-(4-hydroxy-2-methyl-1,3-benzothiazol-6-yl)prop-2-ynamide |
| SMILES | Cc1nc2c(O)cc(C#CC(N)=O)cc2s1 |
| InChI | InChI=1S/C11H8N2O2S/c1-6-13-11-8(14)4-7(2-3-10(12)15)5-9(11)16-6/h4-5,14H,1H3,(H2,12,15) |
| InChIKey | RAGVVXZWVUOTRQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|