C17H16N4O2S — CID 138714136
2-amino-6-[3-(4-amino-2-methoxyanilino)prop-1-ynyl]-1,3-benzothiazol-4-ol (PubChem CID 138714136) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-amino-6-[3-(4-amino-2-methoxyanilino)prop-1-ynyl]-1,3-benzothiazol-4-ol.
| Compound Name | 2-amino-6-[3-(4-amino-2-methoxyanilino)prop-1-ynyl]-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 138714136 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-amino-6-[3-(4-amino-2-methoxyanilino)prop-1-ynyl]-1,3-benzothiazol-4-ol |
| SMILES | COc1cc(N)ccc1NCC#Cc1cc(O)c2nc(N)sc2c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-23-14-9-11(18)4-5-12(14)20-6-2-3-10-7-13(22)16-15(8-10)24-17(19)21-16/h4-5,7-9,20,22H,6,18H2,1H3,(H2,19,21) |
| InChIKey | CGLAUQPCAUKBAX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|