About 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol
2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol (PubChem CID 138713798) has the molecular formula C14H16N4OS
and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol |
| PubChem CID | 138713798 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol |
| SMILES | Nc1nc2c(O)cc(C#CCN3CCNCC3)cc2s1 |
| InChI | InChI=1S/C14H16N4OS/c15-14-17-13-11(19)8-10(9-12(13)20-14)2-1-5-18-6-3-16-4-7-18/h8-9,16,19H,3-7H2,(H2,15,17) |
| InChIKey | NVTSJOLXAOYQRY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol?
The IUPAC name of 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol (CID 138713798) is 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol.
What is the SMILES notation for 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol?
The canonical SMILES for 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol is Nc1nc2c(O)cc(C#CCN3CCNCC3)cc2s1.
What is the InChIKey of 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol?
The InChIKey is NVTSJOLXAOYQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4OS/c15-14-17-13-11(19)8-10(9-12(13)20-14)2-1-5-18-6-3-16-4-7-18/h8-9,16,19H,3-7H2,(H2,15,17).
What are the key properties of 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol?
2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol has a molecular weight of 288.38 g/mol, XLogP of 0.84, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(3-piperazin-1-ylprop-1-ynyl)-1,3-benzothiazol-4-ol is sourced from PubChem (CID 138713798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).