C21H19N5O3S2 — CID 138714062
N-[[7-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-1H-indol-5-yl]methyl]ethenesulfonamide (PubChem CID 138714062) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[[7-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-1H-indol-5-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[7-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-1H-indol-5-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 138714062 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-[[7-[3-(2-amino-4-hydroxy-1,3-benzothiazol-6-yl)prop-2-ynylamino]-1H-indol-5-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCc1cc(NCC#Cc2cc(O)c3nc(N)sc3c2)c2[nH]ccc2c1 |
| InChI | InChI=1S/C21H19N5O3S2/c1-2-31(28,29)25-12-14-8-15-5-7-24-19(15)16(9-14)23-6-3-4-13-10-17(27)20-18(11-13)30-21(22)26-20/h2,5,7-11,23-25,27H,1,6,12H2,(H2,22,26) |
| InChIKey | JPLZYPOHNNWCGS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|