C11H10N2S — CID 138718793
2-cyclopropyl-6-ethenyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 138718793) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-cyclopropyl-6-ethenyl-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-cyclopropyl-6-ethenyl-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 138718793 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-cyclopropyl-6-ethenyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | C=Cc1cnc2nc(C3CC3)sc2c1 |
| InChI | InChI=1S/C11H10N2S/c1-2-7-5-9-10(12-6-7)13-11(14-9)8-3-4-8/h2,5-6,8H,1,3-4H2 |
| InChIKey | IMTYAAKTRIKSEJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |