C17H28F2N4 — CID 138718913
3-[(3E)-8-amino-4-fluoro-3-(1-fluoroethyl)octa-1,3-dienyl]-5-(aminomethyl)-1-methyl-2H-pyridin-6-amine (PubChem CID 138718913) has the molecular formula C17H28F2N4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-[(3E)-8-amino-4-fluoro-3-(1-fluoroethyl)octa-1,3-dienyl]-5-(aminomethyl)-1-methyl-2H-pyridin-6-amine.
| Compound Name | 3-[(3E)-8-amino-4-fluoro-3-(1-fluoroethyl)octa-1,3-dienyl]-5-(aminomethyl)-1-methyl-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 138718913 |
| Molecular Formula | C17H28F2N4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 3-[(3E)-8-amino-4-fluoro-3-(1-fluoroethyl)octa-1,3-dienyl]-5-(aminomethyl)-1-methyl-2H-pyridin-6-amine |
| SMILES | CC(F)/C(C=CC1=CC(CN)=C(N)N(C)C1)=C(/F)CCCCN |
| InChI | InChI=1S/C17H28F2N4/c1-12(18)15(16(19)5-3-4-8-20)7-6-13-9-14(10-21)17(22)23(2)11-13/h6-7,9,12H,3-5,8,10-11,20-22H2,1-2H3/b7-6?,16-15+ |
| InChIKey | ZSJRQFRZPJISMZ-VELCULGWSA-N |
| XLogP | 2.25 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|