C11H15N — CID 138721974
5,5-dimethyl-2,3-dihydro-1H-cyclohepta[b]pyrrole (PubChem CID 138721974) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 5,5-dimethyl-2,3-dihydro-1H-cyclohepta[b]pyrrole.
| Compound Name | 5,5-dimethyl-2,3-dihydro-1H-cyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 138721974 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5,5-dimethyl-2,3-dihydro-1H-cyclohepta[b]pyrrole |
| SMILES | CC1(C)C=CC=C2NCCC2=C1 |
| InChI | InChI=1S/C11H15N/c1-11(2)6-3-4-10-9(8-11)5-7-12-10/h3-4,6,8,12H,5,7H2,1-2H3 |
| InChIKey | QQGVGBANYGSSPJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |