C9H11N — CID 146681435
6-methylidene-1,2,3,5-tetrahydroindole (PubChem CID 146681435) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 6-methylidene-1,2,3,5-tetrahydroindole.
| Compound Name | 6-methylidene-1,2,3,5-tetrahydroindole |
|---|---|
| PubChem CID | 146681435 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 6-methylidene-1,2,3,5-tetrahydroindole |
| SMILES | C=C1C=C2NCCC2=CC1 |
| InChI | InChI=1S/C9H11N/c1-7-2-3-8-4-5-10-9(8)6-7/h3,6,10H,1-2,4-5H2 |
| InChIKey | QXTXMKRBMHUORJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |