About 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine
3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine (PubChem CID 138722472) has the molecular formula C14H26F2N2S
and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine |
| PubChem CID | 138722472 |
| Molecular Formula | C14H26F2N2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine |
| SMILES | CCC(C)N1CSC(C(C)N2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C14H26F2N2S/c1-4-11(2)18-9-13(19-10-18)12(3)17-7-5-14(15,16)6-8-17/h11-13H,4-10H2,1-3H3 |
| InChIKey | MGIGBQMKCNTXBI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine?
The IUPAC name of 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine (CID 138722472) is 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine.
What is the SMILES notation for 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine?
The canonical SMILES for 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine is CCC(C)N1CSC(C(C)N2CCC(F)(F)CC2)C1.
What is the InChIKey of 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine?
The InChIKey is MGIGBQMKCNTXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2S/c1-4-11(2)18-9-13(19-10-18)12(3)17-7-5-14(15,16)6-8-17/h11-13H,4-10H2,1-3H3.
What are the key properties of 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine?
3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine has a molecular weight of 292.44 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-5-[1-(4,4-difluoropiperidin-1-yl)ethyl]-1,3-thiazolidine is sourced from PubChem (CID 138722472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).