C11H17O3PS — CID 138723062
[4-(5-methylthiophen-2-yl)cyclohexyl]phosphonic acid (PubChem CID 138723062) has the molecular formula C11H17O3PS and a molecular weight of 260.29 g/mol. Its IUPAC name is [4-(5-methylthiophen-2-yl)cyclohexyl]phosphonic acid.
| Compound Name | [4-(5-methylthiophen-2-yl)cyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 138723062 |
| Molecular Formula | C11H17O3PS |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [4-(5-methylthiophen-2-yl)cyclohexyl]phosphonic acid |
| SMILES | Cc1ccc(C2CCC(P(=O)(O)O)CC2)s1 |
| InChI | InChI=1S/C11H17O3PS/c1-8-2-7-11(16-8)9-3-5-10(6-4-9)15(12,13)14/h2,7,9-10H,3-6H2,1H3,(H2,12,13,14) |
| InChIKey | OGSCJDRTRJICOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|