C12H18S — CID 118423631
2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene (PubChem CID 118423631) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene.
| Compound Name | 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene |
|---|---|
| PubChem CID | 118423631 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene |
| SMILES | Cc1ccc(C2C[C@@H](C)[C@@H](C)C2)s1 |
| InChI | InChI=1S/C12H18S/c1-8-6-11(7-9(8)2)12-5-4-10(3)13-12/h4-5,8-9,11H,6-7H2,1-3H3/t8-,9+,11? |
| InChIKey | DTYGZURWENAZFY-SLHIUPAKSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |