About 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene
2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene (PubChem CID 118423631) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene |
| PubChem CID | 118423631 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene |
| SMILES | Cc1ccc(C2C[C@@H](C)[C@@H](C)C2)s1 |
| InChI | InChI=1S/C12H18S/c1-8-6-11(7-9(8)2)12-5-4-10(3)13-12/h4-5,8-9,11H,6-7H2,1-3H3/t8-,9+,11? |
| InChIKey | DTYGZURWENAZFY-SLHIUPAKSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene?
The IUPAC name of 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene (CID 118423631) is 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene.
What is the SMILES notation for 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene?
The canonical SMILES for 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene is Cc1ccc(C2C[C@@H](C)[C@@H](C)C2)s1.
What is the InChIKey of 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene?
The InChIKey is DTYGZURWENAZFY-SLHIUPAKSA-N. The full InChI is InChI=1S/C12H18S/c1-8-6-11(7-9(8)2)12-5-4-10(3)13-12/h4-5,8-9,11H,6-7H2,1-3H3/t8-,9+,11?.
What are the key properties of 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene?
2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene has a molecular weight of 194.34 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3,4-dimethylcyclopentyl]-5-methylthiophene is sourced from PubChem (CID 118423631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).