C10H15O3PS2 — CID 138723763
[5-(5-methylthiophen-2-yl)thian-3-yl]phosphonic acid (PubChem CID 138723763) has the molecular formula C10H15O3PS2 and a molecular weight of 278.33 g/mol. Its IUPAC name is [5-(5-methylthiophen-2-yl)thian-3-yl]phosphonic acid.
| Compound Name | [5-(5-methylthiophen-2-yl)thian-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 138723763 |
| Molecular Formula | C10H15O3PS2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | [5-(5-methylthiophen-2-yl)thian-3-yl]phosphonic acid |
| SMILES | Cc1ccc(C2CSCC(P(=O)(O)O)C2)s1 |
| InChI | InChI=1S/C10H15O3PS2/c1-7-2-3-10(16-7)8-4-9(6-15-5-8)14(11,12)13/h2-3,8-9H,4-6H2,1H3,(H2,11,12,13) |
| InChIKey | WCVPLJQRAYSNMK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|