C13H20S — CID 140576019
2-(3,5-dimethylcyclohexyl)-5-methylthiophene (PubChem CID 140576019) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-5-methylthiophene.
| Compound Name | 2-(3,5-dimethylcyclohexyl)-5-methylthiophene |
|---|---|
| PubChem CID | 140576019 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-5-methylthiophene |
| SMILES | Cc1ccc(C2CC(C)CC(C)C2)s1 |
| InChI | InChI=1S/C13H20S/c1-9-6-10(2)8-12(7-9)13-5-4-11(3)14-13/h4-5,9-10,12H,6-8H2,1-3H3 |
| InChIKey | SLMBHFWJPRFFKX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |