C30H31ClF2N2O3S — CID 138726228
3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-N-[(3,5-ditert-butylphenyl)-hydroxymethyl]-2,6-difluorobenzamide (PubChem CID 138726228) has the molecular formula C30H31ClF2N2O3S and a molecular weight of 573.11 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-N-[(3,5-ditert-butylphenyl)-hydroxymethyl]-2,6-difluorobenzamide.
| Compound Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-N-[(3,5-ditert-butylphenyl)-hydroxymethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 138726228 |
| Molecular Formula | C30H31ClF2N2O3S |
| Molecular Weight | 573.11 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-N-[(3,5-ditert-butylphenyl)-hydroxymethyl]-2,6-difluorobenzamide |
| SMILES | CC(C)(C)c1cc(C(O)NC(=O)c2c(F)ccc(OCc3nc4cc(Cl)ccc4s3)c2F)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H31ClF2N2O3S/c1-29(2,3)17-11-16(12-18(13-17)30(4,5)6)27(36)35-28(37)25-20(32)8-9-22(26(25)33)38-15-24-34-21-14-19(31)7-10-23(21)39-24/h7-14,27,36H,15H2,1-6H3,(H,35,37) |
| InChIKey | QNFAOYZOCUZBFR-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.11 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|