C21H22ClFN4O2S — CID 138726027
3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2-fluoro-N-methyl-6-(4-methylpiperazin-1-yl)benzamide (PubChem CID 138726027) has the molecular formula C21H22ClFN4O2S and a molecular weight of 448.95 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2-fluoro-N-methyl-6-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2-fluoro-N-methyl-6-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 138726027 |
| Molecular Formula | C21H22ClFN4O2S |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-[(5-chloro-1,3-benzothiazol-2-yl)methoxy]-2-fluoro-N-methyl-6-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CNC(=O)c1c(N2CCN(C)CC2)ccc(OCc2nc3cc(Cl)ccc3s2)c1F |
| InChI | InChI=1S/C21H22ClFN4O2S/c1-24-21(28)19-15(27-9-7-26(2)8-10-27)4-5-16(20(19)23)29-12-18-25-14-11-13(22)3-6-17(14)30-18/h3-6,11H,7-10,12H2,1-2H3,(H,24,28) |
| InChIKey | OQRFLBAFCVHMDS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|