C22H29N3O6 — CID 138726277
1-O-tert-butyl 3-O-methyl 3-(cyanomethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1,3-dicarboxylate (PubChem CID 138726277) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-(cyanomethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-(cyanomethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 138726277 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-(cyanomethyl)-4-(2-oxo-2-phenylmethoxyethyl)piperazine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(CC#N)CN(C(=O)OC(C)(C)C)CCN1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O6/c1-21(2,3)31-20(28)24-12-13-25(22(16-24,10-11-23)19(27)29-4)14-18(26)30-15-17-8-6-5-7-9-17/h5-9H,10,12-16H2,1-4H3 |
| InChIKey | QULTWAMYDXTUJP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|