C24H32N4O6 — CID 138728338
tert-butyl N-[2-[3-[1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate (PubChem CID 138728338) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[3-[1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138728338 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl N-[2-[3-[1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]prop-2-ynoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOCC#Cc1cccc2c1n(C)c(=O)n2C1CCC(O)NC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N4O6/c1-24(2,3)34-23(32)26(4)13-15-33-14-7-9-16-8-6-10-17-20(16)27(5)22(31)28(17)18-11-12-19(29)25-21(18)30/h6,8,10,18-19,29H,11-15H2,1-5H3,(H,25,30) |
| InChIKey | KUDJPRHVNOCQNX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|