C21H30N4O5 — CID 166734012
1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-4-[3-[[(2S)-morpholin-2-yl]methoxy]propyl]benzimidazol-2-one (PubChem CID 166734012) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-4-[3-[[(2S)-morpholin-2-yl]methoxy]propyl]benzimidazol-2-one.
| Compound Name | 1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-4-[3-[[(2S)-morpholin-2-yl]methoxy]propyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 166734012 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-(6-hydroxy-2-oxopiperidin-3-yl)-3-methyl-4-[3-[[(2S)-morpholin-2-yl]methoxy]propyl]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C2CCC(O)NC2=O)c2cccc(CCCOC[C@@H]3CNCCO3)c21 |
| InChI | InChI=1S/C21H30N4O5/c1-24-19-14(5-3-10-29-13-15-12-22-9-11-30-15)4-2-6-16(19)25(21(24)28)17-7-8-18(26)23-20(17)27/h2,4,6,15,17-18,22,26H,3,5,7-13H2,1H3,(H,23,27)/t15-,17?,18?/m0/s1 |
| InChIKey | VXDKQJIYVLKPLO-ZLPCBKJTSA-N |
| XLogP | 0.05 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|