C26H23N3O2S — CID 138734685
N-[2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]cyclopropyl]-1-(1H-indol-3-yl)methanimine (PubChem CID 138734685) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-[2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]cyclopropyl]-1-(1H-indol-3-yl)methanimine.
| Compound Name | N-[2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]cyclopropyl]-1-(1H-indol-3-yl)methanimine |
|---|---|
| PubChem CID | 138734685 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]cyclopropyl]-1-(1H-indol-3-yl)methanimine |
| SMILES | O=S(=O)(c1ccccc1)N1CCc2cc(C3CC3/N=C/c3c[nH]c4ccccc34)ccc21 |
| InChI | InChI=1S/C26H23N3O2S/c30-32(31,21-6-2-1-3-7-21)29-13-12-19-14-18(10-11-26(19)29)23-15-25(23)28-17-20-16-27-24-9-5-4-8-22(20)24/h1-11,14,16-17,23,25,27H,12-13,15H2/b28-17+ |
| InChIKey | JTAGSYVMDWXXOS-OGLMXYFKSA-N |
| XLogP | 4.89 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|