C11H19N — CID 138739718
[(4aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanamine (PubChem CID 138739718) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is [(4aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanamine.
| Compound Name | [(4aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanamine |
|---|---|
| PubChem CID | 138739718 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | [(4aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanamine |
| SMILES | NCC1=CC2CCCC[C@@H]2CC1 |
| InChI | InChI=1S/C11H19N/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h7,10-11H,1-6,8,12H2/t10-,11?/m1/s1 |
| InChIKey | AJMAZTUPHFEPGF-NFJWQWPMSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|