C12H26O5 — CID 138744605
2-(3-hydroxy-1-pentan-3-yloxybutan-2-yl)oxypropane-1,1-diol (PubChem CID 138744605) has the molecular formula C12H26O5 and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-(3-hydroxy-1-pentan-3-yloxybutan-2-yl)oxypropane-1,1-diol.
| Compound Name | 2-(3-hydroxy-1-pentan-3-yloxybutan-2-yl)oxypropane-1,1-diol |
|---|---|
| PubChem CID | 138744605 |
| Molecular Formula | C12H26O5 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-(3-hydroxy-1-pentan-3-yloxybutan-2-yl)oxypropane-1,1-diol |
| SMILES | CCC(CC)OCC(OC(C)C(O)O)C(C)O |
| InChI | InChI=1S/C12H26O5/c1-5-10(6-2)16-7-11(8(3)13)17-9(4)12(14)15/h8-15H,5-7H2,1-4H3 |
| InChIKey | MIRISIPGQSLQSW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|