C11H24O5 — CID 174078436
2-[(3S)-1-butan-2-yloxy-3-hydroxybutan-2-yl]oxypropane-1,1-diol (PubChem CID 174078436) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[(3S)-1-butan-2-yloxy-3-hydroxybutan-2-yl]oxypropane-1,1-diol.
| Compound Name | 2-[(3S)-1-butan-2-yloxy-3-hydroxybutan-2-yl]oxypropane-1,1-diol |
|---|---|
| PubChem CID | 174078436 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-[(3S)-1-butan-2-yloxy-3-hydroxybutan-2-yl]oxypropane-1,1-diol |
| SMILES | CCC(C)OCC(OC(C)C(O)O)[C@H](C)O |
| InChI | InChI=1S/C11H24O5/c1-5-7(2)15-6-10(8(3)12)16-9(4)11(13)14/h7-14H,5-6H2,1-4H3/t7?,8-,9?,10?/m0/s1 |
| InChIKey | RUIFCQJAZAZIGV-QKTHJCGZSA-N |
| XLogP | 0.27 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|