C6H14O5 — CID 20556668
2-(1,1-dihydroxypropan-2-yloxy)propane-1,1-diol (PubChem CID 20556668) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is 2-(1,1-dihydroxypropan-2-yloxy)propane-1,1-diol.
| Compound Name | 2-(1,1-dihydroxypropan-2-yloxy)propane-1,1-diol |
|---|---|
| PubChem CID | 20556668 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2-(1,1-dihydroxypropan-2-yloxy)propane-1,1-diol |
| SMILES | CC(OC(C)C(O)O)C(O)O |
| InChI | InChI=1S/C6H14O5/c1-3(5(7)8)11-4(2)6(9)10/h3-10H,1-2H3 |
| InChIKey | KMFFKJOTDGWLCD-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|