C22H29N — CID 138745224
N-butyl-3-ethyl-N-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]aniline (PubChem CID 138745224) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is N-butyl-3-ethyl-N-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]aniline.
| Compound Name | N-butyl-3-ethyl-N-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 138745224 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-butyl-3-ethyl-N-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]aniline |
| SMILES | CCCCN(C)c1cc(/C=C/c2ccc(C)cc2)cc(CC)c1 |
| InChI | InChI=1S/C22H29N/c1-5-7-14-23(4)22-16-19(6-2)15-21(17-22)13-12-20-10-8-18(3)9-11-20/h8-13,15-17H,5-7,14H2,1-4H3/b13-12+ |
| InChIKey | ORSMPTOAYJVTNU-OUKQBFOZSA-N |
| XLogP | 5.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|