C30H32FN4O6+ — CID 138752731
3-cyclohexyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-ethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxamide (PubChem CID 138752731) has the molecular formula C30H32FN4O6+ and a molecular weight of 563.61 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-ethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxamide.
| Compound Name | 3-cyclohexyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-ethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 138752731 |
| Molecular Formula | C30H32FN4O6+ |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 3-cyclohexyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-ethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-carboxamide |
| SMILES | CC[N+]1=CC(C(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)c(F)c2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C30H31FN4O6/c1-4-34-17-21(29(37)35(30(34)38)19-8-6-5-7-9-19)28(36)33-18-10-11-25(22(31)14-18)41-24-12-13-32-23-16-27(40-3)26(39-2)15-20(23)24/h10-17,19,21H,4-9H2,1-3H3/p+1 |
| InChIKey | SWZQSVQJMSFVCD-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|