C31H42N6O7 — CID 138807943
(7S)-7-[(2S)-butan-2-yl]-13-[5-(methoxymethyl)furan-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone (PubChem CID 138807943) has the molecular formula C31H42N6O7 and a molecular weight of 610.71 g/mol. Its IUPAC name is (7S)-7-[(2S)-butan-2-yl]-13-[5-(methoxymethyl)furan-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone.
| Compound Name | (7S)-7-[(2S)-butan-2-yl]-13-[5-(methoxymethyl)furan-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
|---|---|
| PubChem CID | 138807943 |
| Molecular Formula | C31H42N6O7 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | (7S)-7-[(2S)-butan-2-yl]-13-[5-(methoxymethyl)furan-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2ccc(COC)o2)CCCNC(=O)c2ccc3[nH]c(=O)n(c3c2)CCCNC1=O |
| InChI | InChI=1S/C31H42N6O7/c1-4-20(2)27-29(40)33-14-7-17-37-24-18-21(9-11-23(24)34-31(37)42)28(39)32-13-6-16-36(15-5-8-26(38)35-27)30(41)25-12-10-22(44-25)19-43-3/h9-12,18,20,27H,4-8,13-17,19H2,1-3H3,(H,32,39)(H,33,40)(H,34,42)(H,35,38)/t20-,27-/m0/s1 |
| InChIKey | NCMLNAUAQJIXDQ-DCFHFQCYSA-N |
| XLogP | 2.16 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |