C30H45N7O5 — CID 138808549
(7S)-7-[(2S)-butan-2-yl]-13-[(2R)-piperidine-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone (PubChem CID 138808549) has the molecular formula C30H45N7O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is (7S)-7-[(2S)-butan-2-yl]-13-[(2R)-piperidine-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone.
| Compound Name | (7S)-7-[(2S)-butan-2-yl]-13-[(2R)-piperidine-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
|---|---|
| PubChem CID | 138808549 |
| Molecular Formula | C30H45N7O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | (7S)-7-[(2S)-butan-2-yl]-13-[(2R)-piperidine-2-carbonyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)[C@H]2CCCCN2)CCCNC(=O)c2ccc3[nH]c(=O)n(c3c2)CCCNC1=O |
| InChI | InChI=1S/C30H45N7O5/c1-3-20(2)26-28(40)33-15-8-18-37-24-19-21(11-12-22(24)34-30(37)42)27(39)32-14-7-17-36(16-6-10-25(38)35-26)29(41)23-9-4-5-13-31-23/h11-12,19-20,23,26,31H,3-10,13-18H2,1-2H3,(H,32,39)(H,33,40)(H,34,42)(H,35,38)/t20-,23+,26-/m0/s1 |
| InChIKey | KGLJLTKFONXEDL-CLLDFNAGSA-N |
| XLogP | 1.25 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |