C34H48N10O5 — CID 138809660
(7S)-7-[(2S)-butan-2-yl]-13-[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone (PubChem CID 138809660) has the molecular formula C34H48N10O5 and a molecular weight of 676.82 g/mol. Its IUPAC name is (7S)-7-[(2S)-butan-2-yl]-13-[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone.
| Compound Name | (7S)-7-[(2S)-butan-2-yl]-13-[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
|---|---|
| PubChem CID | 138809660 |
| Molecular Formula | C34H48N10O5 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | (7S)-7-[(2S)-butan-2-yl]-13-[2-(4-pyrimidin-2-ylpiperazin-1-yl)acetyl]-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)CN2CCN(c3ncccn3)CC2)CCCNC(=O)c2ccc3[nH]c(=O)n(c3c2)CCCNC1=O |
| InChI | InChI=1S/C34H48N10O5/c1-3-24(2)30-32(48)36-14-7-17-44-27-22-25(9-10-26(27)39-34(44)49)31(47)35-13-6-16-42(15-4-8-28(45)40-30)29(46)23-41-18-20-43(21-19-41)33-37-11-5-12-38-33/h5,9-12,22,24,30H,3-4,6-8,13-21,23H2,1-2H3,(H,35,47)(H,36,48)(H,39,49)(H,40,45)/t24-,30-/m0/s1 |
| InChIKey | FVYVNROVKPIGIP-NGQVCNFZSA-N |
| XLogP | 0.72 |
| TPSA | 177.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |