C28H38N8O6 — CID 138806179
(7S)-7-[(2S)-butan-2-yl]-13-(4-methyl-1,2,5-oxadiazole-3-carbonyl)-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone (PubChem CID 138806179) has the molecular formula C28H38N8O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is (7S)-7-[(2S)-butan-2-yl]-13-(4-methyl-1,2,5-oxadiazole-3-carbonyl)-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone.
| Compound Name | (7S)-7-[(2S)-butan-2-yl]-13-(4-methyl-1,2,5-oxadiazole-3-carbonyl)-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
|---|---|
| PubChem CID | 138806179 |
| Molecular Formula | C28H38N8O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | (7S)-7-[(2S)-butan-2-yl]-13-(4-methyl-1,2,5-oxadiazole-3-carbonyl)-1,5,8,13,17,23-hexazatricyclo[17.5.2.022,25]hexacosa-19(26),20,22(25)-triene-6,9,18,24-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCCN(C(=O)c2nonc2C)CCCNC(=O)c2ccc3[nH]c(=O)n(c3c2)CCCNC1=O |
| InChI | InChI=1S/C28H38N8O6/c1-4-17(2)23-26(39)30-12-7-15-36-21-16-19(9-10-20(21)31-28(36)41)25(38)29-11-6-14-35(13-5-8-22(37)32-23)27(40)24-18(3)33-42-34-24/h9-10,16-17,23H,4-8,11-15H2,1-3H3,(H,29,38)(H,30,39)(H,31,41)(H,32,37)/t17-,23-/m0/s1 |
| InChIKey | GJTPUNORQJFAPE-SBUREZEXSA-N |
| XLogP | 1.11 |
| TPSA | 184.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |