About diazido(methyl)-λ3-iodane
diazido(methyl)-λ3-iodane (PubChem CID 138963112) has the molecular formula CH3IN6
and a molecular weight of 225.98 g/mol. Its IUPAC name is diazido(methyl)-λ3-iodane.
Molecular Properties
| Compound Name | diazido(methyl)-λ3-iodane |
| PubChem CID | 138963112 |
| Molecular Formula | CH3IN6 |
| Molecular Weight | 225.98 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | diazido(methyl)-λ3-iodane |
| SMILES | CI(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/CH3IN6/c1-2(5-7-3)6-8-4/h1H3 |
| InChIKey | OWAZEGMOLRWOQG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.98 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diazido(methyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazido(methyl)-λ3-iodane?
The IUPAC name of diazido(methyl)-λ3-iodane (CID 138963112) is diazido(methyl)-λ3-iodane.
What is the SMILES notation for diazido(methyl)-λ3-iodane?
The canonical SMILES for diazido(methyl)-λ3-iodane is CI(N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of diazido(methyl)-λ3-iodane?
The InChIKey is OWAZEGMOLRWOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3IN6/c1-2(5-7-3)6-8-4/h1H3.
What are the key properties of diazido(methyl)-λ3-iodane?
diazido(methyl)-λ3-iodane has a molecular weight of 225.98 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diazido(methyl)-λ3-iodane is sourced from PubChem (CID 138963112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).