About azidomethane;ethane;yttrium
azidomethane;ethane;yttrium (PubChem CID 58101916) has the molecular formula C3H7N3Y-2
and a molecular weight of 174.02 g/mol. Its IUPAC name is azidomethane;ethane;yttrium.
Molecular Properties
| Compound Name | azidomethane;ethane;yttrium |
| PubChem CID | 58101916 |
| Molecular Formula | C3H7N3Y-2 |
| Molecular Weight | 174.02 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | azidomethane;ethane;yttrium |
| SMILES | [CH2-]C.[CH2-]N=[N+]=[N-].[Y] |
| InChI | InChI=1S/C2H5.CH2N3.Y/c1-2;1-3-4-2;/h1H2,2H3;1H2;/q2*-1; |
| InChIKey | PNAFPTUQRJRZFE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.02 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethane;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethane;ethane;yttrium?
The IUPAC name of azidomethane;ethane;yttrium (CID 58101916) is azidomethane;ethane;yttrium.
What is the SMILES notation for azidomethane;ethane;yttrium?
The canonical SMILES for azidomethane;ethane;yttrium is [CH2-]C.[CH2-]N=[N+]=[N-].[Y].
What is the InChIKey of azidomethane;ethane;yttrium?
The InChIKey is PNAFPTUQRJRZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5.CH2N3.Y/c1-2;1-3-4-2;/h1H2,2H3;1H2;/q2*-1;.
What are the key properties of azidomethane;ethane;yttrium?
azidomethane;ethane;yttrium has a molecular weight of 174.02 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethane;ethane;yttrium is sourced from PubChem (CID 58101916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).