About [diazido(trimethyl)-λ6-tellanyl]methane
[diazido(trimethyl)-λ6-tellanyl]methane (PubChem CID 139264952) has the molecular formula C4H12N6Te
and a molecular weight of 271.78 g/mol. Its IUPAC name is [diazido(trimethyl)-λ6-tellanyl]methane.
Molecular Properties
| Compound Name | [diazido(trimethyl)-λ6-tellanyl]methane |
| PubChem CID | 139264952 |
| Molecular Formula | C4H12N6Te |
| Molecular Weight | 271.78 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | [diazido(trimethyl)-λ6-tellanyl]methane |
| SMILES | C[Te](C)(C)(C)(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C4H12N6Te/c1-11(2,3,4,9-7-5)10-8-6/h1-4H3 |
| InChIKey | ASXOTSRSJRNWPL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [diazido(trimethyl)-λ6-tellanyl]methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diazido(trimethyl)-λ6-tellanyl]methane?
The IUPAC name of [diazido(trimethyl)-λ6-tellanyl]methane (CID 139264952) is [diazido(trimethyl)-λ6-tellanyl]methane.
What is the SMILES notation for [diazido(trimethyl)-λ6-tellanyl]methane?
The canonical SMILES for [diazido(trimethyl)-λ6-tellanyl]methane is C[Te](C)(C)(C)(N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of [diazido(trimethyl)-λ6-tellanyl]methane?
The InChIKey is ASXOTSRSJRNWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N6Te/c1-11(2,3,4,9-7-5)10-8-6/h1-4H3.
What are the key properties of [diazido(trimethyl)-λ6-tellanyl]methane?
[diazido(trimethyl)-λ6-tellanyl]methane has a molecular weight of 271.78 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diazido(trimethyl)-λ6-tellanyl]methane is sourced from PubChem (CID 139264952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).