C24H26F6N2O7 — CID 138965756
1-O-tert-butyl 2-O',2-O'-diethyl (3S,4'R,5'R)-2-oxo-4',5'-bis(trifluoromethyl)spiro[indole-3,3'-pyrrolidine]-1,2',2'-tricarboxylate (PubChem CID 138965756) has the molecular formula C24H26F6N2O7 and a molecular weight of 568.47 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O',2-O'-diethyl (3S,4'R,5'R)-2-oxo-4',5'-bis(trifluoromethyl)spiro[indole-3,3'-pyrrolidine]-1,2',2'-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O',2-O'-diethyl (3S,4'R,5'R)-2-oxo-4',5'-bis(trifluoromethyl)spiro[indole-3,3'-pyrrolidine]-1,2',2'-tricarboxylate |
|---|---|
| PubChem CID | 138965756 |
| Molecular Formula | C24H26F6N2O7 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 1-O-tert-butyl 2-O',2-O'-diethyl (3S,4'R,5'R)-2-oxo-4',5'-bis(trifluoromethyl)spiro[indole-3,3'-pyrrolidine]-1,2',2'-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N[C@@H](C(F)(F)F)[C@H](C(F)(F)F)[C@@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C24H26F6N2O7/c1-6-37-17(34)22(18(35)38-7-2)21(14(23(25,26)27)15(31-22)24(28,29)30)12-10-8-9-11-13(12)32(16(21)33)19(36)39-20(3,4)5/h8-11,14-15,31H,6-7H2,1-5H3/t14-,15+,21-/m0/s1 |
| InChIKey | ZCCYDMSZIRBYEV-ZSDSOXJFSA-N |
| XLogP | 3.78 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|