C14H26O3 — CID 138965828
butyl 6-hydroxy-4,4-dimethyl-2-methylideneheptanoate (PubChem CID 138965828) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is butyl 6-hydroxy-4,4-dimethyl-2-methylideneheptanoate.
| Compound Name | butyl 6-hydroxy-4,4-dimethyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 138965828 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | butyl 6-hydroxy-4,4-dimethyl-2-methylideneheptanoate |
| SMILES | C=C(CC(C)(C)CC(C)O)C(=O)OCCCC |
| InChI | InChI=1S/C14H26O3/c1-6-7-8-17-13(16)11(2)9-14(4,5)10-12(3)15/h12,15H,2,6-10H2,1,3-5H3 |
| InChIKey | PBRSPCGZASAAQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|